C17H16F6O3 — CID 162600090
methyl 3-[1-[(3R)-3,5-bis(trifluoromethyl)cyclohexa-1,5-dien-1-yl]ethenoxy]cyclopentene-1-carboxylate (PubChem CID 162600090) has the molecular formula C17H16F6O3 and a molecular weight of 382.30 g/mol. Its IUPAC name is methyl 3-[1-[(3R)-3,5-bis(trifluoromethyl)cyclohexa-1,5-dien-1-yl]ethenoxy]cyclopentene-1-carboxylate.
| Compound Name | methyl 3-[1-[(3R)-3,5-bis(trifluoromethyl)cyclohexa-1,5-dien-1-yl]ethenoxy]cyclopentene-1-carboxylate |
|---|---|
| PubChem CID | 162600090 |
| Molecular Formula | C17H16F6O3 |
| Molecular Weight | 382.30 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | methyl 3-[1-[(3R)-3,5-bis(trifluoromethyl)cyclohexa-1,5-dien-1-yl]ethenoxy]cyclopentene-1-carboxylate |
| SMILES | C=C(OC1C=C(C(=O)OC)CC1)C1=C[C@H](C(F)(F)F)CC(C(F)(F)F)=C1 |
| InChI | InChI=1S/C17H16F6O3/c1-9(26-14-4-3-10(7-14)15(24)25-2)11-5-12(16(18,19)20)8-13(6-11)17(21,22)23/h5-7,12,14H,1,3-4,8H2,2H3/t12-,14?/m0/s1 |
| InChIKey | GGKZNOMXIDFALE-NBFOIZRFSA-N |
| XLogP | 4.78 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.30 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|