C12H10F14O3 — CID 162600133
(Z)-4,5,5,5-tetrafluoro-3-[4,5,5,5-tetrafluoro-1-hydroxy-4-(trifluoromethyl)pentan-2-yl]oxy-4-(trifluoromethyl)pent-2-en-1-ol (PubChem CID 162600133) has the molecular formula C12H10F14O3 and a molecular weight of 468.18 g/mol. Its IUPAC name is (Z)-4,5,5,5-tetrafluoro-3-[4,5,5,5-tetrafluoro-1-hydroxy-4-(trifluoromethyl)pentan-2-yl]oxy-4-(trifluoromethyl)pent-2-en-1-ol.
| Compound Name | (Z)-4,5,5,5-tetrafluoro-3-[4,5,5,5-tetrafluoro-1-hydroxy-4-(trifluoromethyl)pentan-2-yl]oxy-4-(trifluoromethyl)pent-2-en-1-ol |
|---|---|
| PubChem CID | 162600133 |
| Molecular Formula | C12H10F14O3 |
| Molecular Weight | 468.18 g/mol |
| Exact Mass | 468.04 |
| IUPAC Name | (Z)-4,5,5,5-tetrafluoro-3-[4,5,5,5-tetrafluoro-1-hydroxy-4-(trifluoromethyl)pentan-2-yl]oxy-4-(trifluoromethyl)pent-2-en-1-ol |
| SMILES | OC/C=C(\OC(CO)CC(F)(C(F)(F)F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H10F14O3/c13-7(9(15,16)17,10(18,19)20)3-5(4-28)29-6(1-2-27)8(14,11(21,22)23)12(24,25)26/h1,5,27-28H,2-4H2/b6-1- |
| InChIKey | MIQQFKRDGUNYOK-BHQIHCQQSA-N |
| XLogP | 4.30 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.18 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|