About 3-amino-4,4-difluoro-2-(methyliminomethyl)but-2-enoic acid
3-amino-4,4-difluoro-2-(methyliminomethyl)but-2-enoic acid (PubChem CID 162600394) has the molecular formula C6H8F2N2O2
and a molecular weight of 178.14 g/mol. Its IUPAC name is 3-amino-4,4-difluoro-2-(methyliminomethyl)but-2-enoic acid.
Molecular Properties
| Compound Name | 3-amino-4,4-difluoro-2-(methyliminomethyl)but-2-enoic acid |
| PubChem CID | 162600394 |
| Molecular Formula | C6H8F2N2O2 |
| Molecular Weight | 178.14 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 3-amino-4,4-difluoro-2-(methyliminomethyl)but-2-enoic acid |
| SMILES | C/N=C/C(C(=O)O)=C(N)C(F)F |
| InChI | InChI=1S/C6H8F2N2O2/c1-10-2-3(6(11)12)4(9)5(7)8/h2,5H,9H2,1H3,(H,11,12)/b4-3?,10-2+ |
| InChIKey | PYDJVBDYNOFIQA-WDPNBVCMSA-N |
| XLogP | 0.25 |
| TPSA | 75.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.14 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-4,4-difluoro-2-(methyliminomethyl)but-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-4,4-difluoro-2-(methyliminomethyl)but-2-enoic acid?
The IUPAC name of 3-amino-4,4-difluoro-2-(methyliminomethyl)but-2-enoic acid (CID 162600394) is 3-amino-4,4-difluoro-2-(methyliminomethyl)but-2-enoic acid.
What is the SMILES notation for 3-amino-4,4-difluoro-2-(methyliminomethyl)but-2-enoic acid?
The canonical SMILES for 3-amino-4,4-difluoro-2-(methyliminomethyl)but-2-enoic acid is C/N=C/C(C(=O)O)=C(N)C(F)F.
What is the InChIKey of 3-amino-4,4-difluoro-2-(methyliminomethyl)but-2-enoic acid?
The InChIKey is PYDJVBDYNOFIQA-WDPNBVCMSA-N. The full InChI is InChI=1S/C6H8F2N2O2/c1-10-2-3(6(11)12)4(9)5(7)8/h2,5H,9H2,1H3,(H,11,12)/b4-3?,10-2+.
What are the key properties of 3-amino-4,4-difluoro-2-(methyliminomethyl)but-2-enoic acid?
3-amino-4,4-difluoro-2-(methyliminomethyl)but-2-enoic acid has a molecular weight of 178.14 g/mol, XLogP of 0.25, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4,4-difluoro-2-(methyliminomethyl)but-2-enoic acid is sourced from PubChem (CID 162600394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).