C14H24F3N — CID 162600980
(2Z,4Z)-N-butyl-1,1,1-trifluoro-5,6-dimethylocta-2,4-dien-2-amine (PubChem CID 162600980) has the molecular formula C14H24F3N and a molecular weight of 263.35 g/mol. Its IUPAC name is (2Z,4Z)-N-butyl-1,1,1-trifluoro-5,6-dimethylocta-2,4-dien-2-amine.
| Compound Name | (2Z,4Z)-N-butyl-1,1,1-trifluoro-5,6-dimethylocta-2,4-dien-2-amine |
|---|---|
| PubChem CID | 162600980 |
| Molecular Formula | C14H24F3N |
| Molecular Weight | 263.35 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | (2Z,4Z)-N-butyl-1,1,1-trifluoro-5,6-dimethylocta-2,4-dien-2-amine |
| SMILES | CCCCN/C(=C\C=C(\C)C(C)CC)C(F)(F)F |
| InChI | InChI=1S/C14H24F3N/c1-5-7-10-18-13(14(15,16)17)9-8-12(4)11(3)6-2/h8-9,11,18H,5-7,10H2,1-4H3/b12-8-,13-9- |
| InChIKey | QHXMTDQEGCDMPM-JMVBYTIWSA-N |
| XLogP | 4.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.35 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|