C20H17F5N4O2 — CID 162601097
N-[3-(1,1-difluoroethyl)phenyl]-4-(3-methoxyphenyl)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-amine (PubChem CID 162601097) has the molecular formula C20H17F5N4O2 and a molecular weight of 440.37 g/mol. Its IUPAC name is N-[3-(1,1-difluoroethyl)phenyl]-4-(3-methoxyphenyl)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-amine.
| Compound Name | N-[3-(1,1-difluoroethyl)phenyl]-4-(3-methoxyphenyl)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 162601097 |
| Molecular Formula | C20H17F5N4O2 |
| Molecular Weight | 440.37 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | N-[3-(1,1-difluoroethyl)phenyl]-4-(3-methoxyphenyl)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-amine |
| SMILES | COc1cccc(-c2nc(Nc3cccc(C(C)(F)F)c3)nc(OCC(F)(F)F)n2)c1 |
| InChI | InChI=1S/C20H17F5N4O2/c1-19(21,22)13-6-4-7-14(10-13)26-17-27-16(12-5-3-8-15(9-12)30-2)28-18(29-17)31-11-20(23,24)25/h3-10H,11H2,1-2H3,(H,26,27,28,29) |
| InChIKey | BNAUGCPDHPUDAY-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.37 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |