C14H19BrF3NO — CID 162601212
N-[(4Z,6E)-6-bromo-4-[(Z)-but-1-enyl]octa-4,6-dienyl]-2,2,2-trifluoroacetamide (PubChem CID 162601212) has the molecular formula C14H19BrF3NO and a molecular weight of 354.21 g/mol. Its IUPAC name is N-[(4Z,6E)-6-bromo-4-[(Z)-but-1-enyl]octa-4,6-dienyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(4Z,6E)-6-bromo-4-[(Z)-but-1-enyl]octa-4,6-dienyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 162601212 |
| Molecular Formula | C14H19BrF3NO |
| Molecular Weight | 354.21 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | N-[(4Z,6E)-6-bromo-4-[(Z)-but-1-enyl]octa-4,6-dienyl]-2,2,2-trifluoroacetamide |
| SMILES | C/C=C(Br)\C=C(/C=C\CC)CCCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C14H19BrF3NO/c1-3-5-7-11(10-12(15)4-2)8-6-9-19-13(20)14(16,17)18/h4-5,7,10H,3,6,8-9H2,1-2H3,(H,19,20)/b7-5-,11-10+,12-4+ |
| InChIKey | XGLYOLFOWNUMQW-FQHFPLNYSA-N |
| XLogP | 4.64 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.21 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|