C18H22F6O6 — CID 162601265
[6-[1,1,1,3,3,3-hexafluoropropan-2-yloxy(hydroxy)methyl]-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 2-methylpentanoate (PubChem CID 162601265) has the molecular formula C18H22F6O6 and a molecular weight of 448.36 g/mol. Its IUPAC name is [6-[1,1,1,3,3,3-hexafluoropropan-2-yloxy(hydroxy)methyl]-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 2-methylpentanoate.
| Compound Name | [6-[1,1,1,3,3,3-hexafluoropropan-2-yloxy(hydroxy)methyl]-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 2-methylpentanoate |
|---|---|
| PubChem CID | 162601265 |
| Molecular Formula | C18H22F6O6 |
| Molecular Weight | 448.36 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | [6-[1,1,1,3,3,3-hexafluoropropan-2-yloxy(hydroxy)methyl]-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 2-methylpentanoate |
| SMILES | CCCC(C)C(=O)OC1C2CC3C1OC(=O)C3(C(O)OC(C(F)(F)F)C(F)(F)F)C2 |
| InChI | InChI=1S/C18H22F6O6/c1-3-4-7(2)12(25)28-10-8-5-9-11(10)29-14(26)16(9,6-8)15(27)30-13(17(19,20)21)18(22,23)24/h7-11,13,15,27H,3-6H2,1-2H3 |
| InChIKey | IBIFSAZRPWPFBY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.36 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|