About dioxotechnetium(1+);6-(trifluoromethyl)-3H-pyridin-3-ide
dioxotechnetium(1+);6-(trifluoromethyl)-3H-pyridin-3-ide (PubChem CID 162601299) has the molecular formula C6H3F3NO2Tc
and a molecular weight of 276.09 g/mol. Its IUPAC name is dioxotechnetium(1+);6-(trifluoromethyl)-3H-pyridin-3-ide.
Molecular Properties
| Compound Name | dioxotechnetium(1+);6-(trifluoromethyl)-3H-pyridin-3-ide |
| PubChem CID | 162601299 |
| Molecular Formula | C6H3F3NO2Tc |
| Molecular Weight | 276.09 g/mol |
| Exact Mass | 274.92 |
| IUPAC Name | dioxotechnetium(1+);6-(trifluoromethyl)-3H-pyridin-3-ide |
| SMILES | FC(F)(F)c1cc[c-]cn1.O=[Tc+]=O |
| InChI | InChI=1S/C6H3F3N.2O.Tc/c7-6(8,9)5-3-1-2-4-10-5;;;/h1,3-4H;;;/q-1;;;+1 |
| InChIKey | KGDAVAICHOYCIU-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.09 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze dioxotechnetium(1+);6-(trifluoromethyl)-3H-pyridin-3-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioxotechnetium(1+);6-(trifluoromethyl)-3H-pyridin-3-ide?
The IUPAC name of dioxotechnetium(1+);6-(trifluoromethyl)-3H-pyridin-3-ide (CID 162601299) is dioxotechnetium(1+);6-(trifluoromethyl)-3H-pyridin-3-ide.
What is the SMILES notation for dioxotechnetium(1+);6-(trifluoromethyl)-3H-pyridin-3-ide?
The canonical SMILES for dioxotechnetium(1+);6-(trifluoromethyl)-3H-pyridin-3-ide is FC(F)(F)c1cc[c-]cn1.O=[Tc+]=O.
What is the InChIKey of dioxotechnetium(1+);6-(trifluoromethyl)-3H-pyridin-3-ide?
The InChIKey is KGDAVAICHOYCIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3F3N.2O.Tc/c7-6(8,9)5-3-1-2-4-10-5;;;/h1,3-4H;;;/q-1;;;+1.
What are the key properties of dioxotechnetium(1+);6-(trifluoromethyl)-3H-pyridin-3-ide?
dioxotechnetium(1+);6-(trifluoromethyl)-3H-pyridin-3-ide has a molecular weight of 276.09 g/mol, XLogP of 1.66, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dioxotechnetium(1+);6-(trifluoromethyl)-3H-pyridin-3-ide is sourced from PubChem (CID 162601299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).