C20H16F5N3O2S — CID 162601466
7,7-difluoro-4-methyl-15-[4-(trifluoromethyl)phenyl]sulfonyl-4,5,15-triazatetracyclo[6.6.1.02,6.09,14]pentadeca-2(6),9,11,13-tetraene (PubChem CID 162601466) has the molecular formula C20H16F5N3O2S and a molecular weight of 457.42 g/mol. Its IUPAC name is 7,7-difluoro-4-methyl-15-[4-(trifluoromethyl)phenyl]sulfonyl-4,5,15-triazatetracyclo[6.6.1.02,6.09,14]pentadeca-2(6),9,11,13-tetraene.
| Compound Name | 7,7-difluoro-4-methyl-15-[4-(trifluoromethyl)phenyl]sulfonyl-4,5,15-triazatetracyclo[6.6.1.02,6.09,14]pentadeca-2(6),9,11,13-tetraene |
|---|---|
| PubChem CID | 162601466 |
| Molecular Formula | C20H16F5N3O2S |
| Molecular Weight | 457.42 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | 7,7-difluoro-4-methyl-15-[4-(trifluoromethyl)phenyl]sulfonyl-4,5,15-triazatetracyclo[6.6.1.02,6.09,14]pentadeca-2(6),9,11,13-tetraene |
| SMILES | CN1CC2=C(N1)C(F)(F)C1c3ccccc3C2N1S(=O)(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H16F5N3O2S/c1-27-10-15-16-13-4-2-3-5-14(13)18(19(21,22)17(15)26-27)28(16)31(29,30)12-8-6-11(7-9-12)20(23,24)25/h2-9,16,18,26H,10H2,1H3 |
| InChIKey | QTWAGJGHPMSGBS-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.42 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |