C17H19F3N4O4 — CID 162601716
1-[(7R)-7-ethyl-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-yl]-N-[[4-(trifluoromethoxy)phenyl]methyl]methanamine (PubChem CID 162601716) has the molecular formula C17H19F3N4O4 and a molecular weight of 400.36 g/mol. Its IUPAC name is 1-[(7R)-7-ethyl-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-yl]-N-[[4-(trifluoromethoxy)phenyl]methyl]methanamine.
| Compound Name | 1-[(7R)-7-ethyl-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-yl]-N-[[4-(trifluoromethoxy)phenyl]methyl]methanamine |
|---|---|
| PubChem CID | 162601716 |
| Molecular Formula | C17H19F3N4O4 |
| Molecular Weight | 400.36 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 1-[(7R)-7-ethyl-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-yl]-N-[[4-(trifluoromethoxy)phenyl]methyl]methanamine |
| SMILES | CC[C@H]1Oc2nc([N+](=O)[O-])cn2CC1CNCc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H19F3N4O4/c1-2-14-12(9-23-10-15(24(25)26)22-16(23)27-14)8-21-7-11-3-5-13(6-4-11)28-17(18,19)20/h3-6,10,12,14,21H,2,7-9H2,1H3/t12?,14-/m1/s1 |
| InChIKey | MZAMSAQPKHLQHR-TYZXPVIJSA-N |
| XLogP | 3.27 |
| TPSA | 91.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.36 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|