C23H23F3N8 — CID 162601949
(7R)-8-(3,3-difluorocyclobutyl)-5-ethanimidoyl-7-ethyl-2-[2-(3-fluorophenyl)imidazol-1-yl]-7H-pteridin-6-imine (PubChem CID 162601949) has the molecular formula C23H23F3N8 and a molecular weight of 468.49 g/mol. Its IUPAC name is (7R)-8-(3,3-difluorocyclobutyl)-5-ethanimidoyl-7-ethyl-2-[2-(3-fluorophenyl)imidazol-1-yl]-7H-pteridin-6-imine.
| Compound Name | (7R)-8-(3,3-difluorocyclobutyl)-5-ethanimidoyl-7-ethyl-2-[2-(3-fluorophenyl)imidazol-1-yl]-7H-pteridin-6-imine |
|---|---|
| PubChem CID | 162601949 |
| Molecular Formula | C23H23F3N8 |
| Molecular Weight | 468.49 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | (7R)-8-(3,3-difluorocyclobutyl)-5-ethanimidoyl-7-ethyl-2-[2-(3-fluorophenyl)imidazol-1-yl]-7H-pteridin-6-imine |
| SMILES | [H]/N=C1/[C@@H](CC)N(C2CC(F)(F)C2)c2nc(-n3ccnc3-c3cccc(F)c3)ncc2N1/C(C)=N/[H] |
| InChI | InChI=1S/C23H23F3N8/c1-3-17-19(28)33(13(2)27)18-12-30-22(31-21(18)34(17)16-10-23(25,26)11-16)32-8-7-29-20(32)14-5-4-6-15(24)9-14/h4-9,12,16-17,27-28H,3,10-11H2,1-2H3/b27-13+,28-19-/t17-/m1/s1 |
| InChIKey | KASMJHPQHKXCAK-MMLALEMRSA-N |
| XLogP | 4.65 |
| TPSA | 97.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.49 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|