C11H12F5NO — CID 162602089
N-[[5-(1,1-difluoroethyl)-3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methyl]formamide (PubChem CID 162602089) has the molecular formula C11H12F5NO and a molecular weight of 269.21 g/mol. Its IUPAC name is N-[[5-(1,1-difluoroethyl)-3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methyl]formamide.
| Compound Name | N-[[5-(1,1-difluoroethyl)-3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methyl]formamide |
|---|---|
| PubChem CID | 162602089 |
| Molecular Formula | C11H12F5NO |
| Molecular Weight | 269.21 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | N-[[5-(1,1-difluoroethyl)-3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methyl]formamide |
| SMILES | CC(F)(F)C1=CC(C(F)(F)F)=CC(CNC=O)C1 |
| InChI | InChI=1S/C11H12F5NO/c1-10(12,13)8-2-7(5-17-6-18)3-9(4-8)11(14,15)16/h3-4,6-7H,2,5H2,1H3,(H,17,18) |
| InChIKey | CHHBQXPRCZGUFH-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.21 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|