C17H15F3O4 — CID 162602245
[2-hydroxy-1-[3-[4-(trifluoromethoxy)phenyl]phenyl]ethyl] acetate (PubChem CID 162602245) has the molecular formula C17H15F3O4 and a molecular weight of 340.30 g/mol. Its IUPAC name is [2-hydroxy-1-[3-[4-(trifluoromethoxy)phenyl]phenyl]ethyl] acetate.
| Compound Name | [2-hydroxy-1-[3-[4-(trifluoromethoxy)phenyl]phenyl]ethyl] acetate |
|---|---|
| PubChem CID | 162602245 |
| Molecular Formula | C17H15F3O4 |
| Molecular Weight | 340.30 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | [2-hydroxy-1-[3-[4-(trifluoromethoxy)phenyl]phenyl]ethyl] acetate |
| SMILES | CC(=O)OC(CO)c1cccc(-c2ccc(OC(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C17H15F3O4/c1-11(22)23-16(10-21)14-4-2-3-13(9-14)12-5-7-15(8-6-12)24-17(18,19)20/h2-9,16,21H,10H2,1H3 |
| InChIKey | JCRMSVXIHNVIBX-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.30 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |