C21H28F3N3O3S — CID 162603582
5-[2-[3-methoxy-4-(4,4,4-trifluorobutoxy)phenyl]ethyl]-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-one (PubChem CID 162603582) has the molecular formula C21H28F3N3O3S and a molecular weight of 459.53 g/mol. Its IUPAC name is 5-[2-[3-methoxy-4-(4,4,4-trifluorobutoxy)phenyl]ethyl]-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-one.
| Compound Name | 5-[2-[3-methoxy-4-(4,4,4-trifluorobutoxy)phenyl]ethyl]-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 162603582 |
| Molecular Formula | C21H28F3N3O3S |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | 5-[2-[3-methoxy-4-(4,4,4-trifluorobutoxy)phenyl]ethyl]-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-one |
| SMILES | COc1cc(CCC2SC(N3CCN(C)CC3)=NC2=O)ccc1OCCCC(F)(F)F |
| InChI | InChI=1S/C21H28F3N3O3S/c1-26-9-11-27(12-10-26)20-25-19(28)18(31-20)7-5-15-4-6-16(17(14-15)29-2)30-13-3-8-21(22,23)24/h4,6,14,18H,3,5,7-13H2,1-2H3 |
| InChIKey | RHCKXMNGQIKMLX-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 54.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|