C13H14ClF6N3O2S — CID 162603750
2-chloro-N'-[1-[(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)amino]ethenyl]-6-methylbenzenesulfonohydrazide (PubChem CID 162603750) has the molecular formula C13H14ClF6N3O2S and a molecular weight of 425.78 g/mol. Its IUPAC name is 2-chloro-N'-[1-[(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)amino]ethenyl]-6-methylbenzenesulfonohydrazide.
| Compound Name | 2-chloro-N'-[1-[(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)amino]ethenyl]-6-methylbenzenesulfonohydrazide |
|---|---|
| PubChem CID | 162603750 |
| Molecular Formula | C13H14ClF6N3O2S |
| Molecular Weight | 425.78 g/mol |
| Exact Mass | 425.04 |
| IUPAC Name | 2-chloro-N'-[1-[(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)amino]ethenyl]-6-methylbenzenesulfonohydrazide |
| SMILES | C=C(NNS(=O)(=O)c1c(C)cccc1Cl)NC(C)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H14ClF6N3O2S/c1-7-5-4-6-9(14)10(7)26(24,25)23-22-8(2)21-11(3,12(15,16)17)13(18,19)20/h4-6,21-23H,2H2,1,3H3 |
| InChIKey | RRCJGNQFAMVLQZ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.78 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|