About [(2-acetamido-6-bromo-1,3-benzothiazol-5-yl)-difluoromethyl]phosphonous acid
[(2-acetamido-6-bromo-1,3-benzothiazol-5-yl)-difluoromethyl]phosphonous acid (PubChem CID 162604049) has the molecular formula C10H8BrF2N2O3PS
and a molecular weight of 385.13 g/mol. Its IUPAC name is [(2-acetamido-6-bromo-1,3-benzothiazol-5-yl)-difluoromethyl]phosphonous acid.
Molecular Properties
| Compound Name | [(2-acetamido-6-bromo-1,3-benzothiazol-5-yl)-difluoromethyl]phosphonous acid |
| PubChem CID | 162604049 |
| Molecular Formula | C10H8BrF2N2O3PS |
| Molecular Weight | 385.13 g/mol |
| Exact Mass | 383.91 |
| IUPAC Name | [(2-acetamido-6-bromo-1,3-benzothiazol-5-yl)-difluoromethyl]phosphonous acid |
| SMILES | CC(=O)Nc1nc2cc(C(F)(F)P(O)O)c(Br)cc2s1 |
| InChI | InChI=1S/C10H8BrF2N2O3PS/c1-4(16)14-9-15-7-2-5(10(12,13)19(17)18)6(11)3-8(7)20-9/h2-3,17-18H,1H3,(H,14,15,16) |
| InChIKey | QHSLTJHKVHLJSK-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.13 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(2-acetamido-6-bromo-1,3-benzothiazol-5-yl)-difluoromethyl]phosphonous acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2-acetamido-6-bromo-1,3-benzothiazol-5-yl)-difluoromethyl]phosphonous acid?
The IUPAC name of [(2-acetamido-6-bromo-1,3-benzothiazol-5-yl)-difluoromethyl]phosphonous acid (CID 162604049) is [(2-acetamido-6-bromo-1,3-benzothiazol-5-yl)-difluoromethyl]phosphonous acid.
What is the SMILES notation for [(2-acetamido-6-bromo-1,3-benzothiazol-5-yl)-difluoromethyl]phosphonous acid?
The canonical SMILES for [(2-acetamido-6-bromo-1,3-benzothiazol-5-yl)-difluoromethyl]phosphonous acid is CC(=O)Nc1nc2cc(C(F)(F)P(O)O)c(Br)cc2s1.
What is the InChIKey of [(2-acetamido-6-bromo-1,3-benzothiazol-5-yl)-difluoromethyl]phosphonous acid?
The InChIKey is QHSLTJHKVHLJSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8BrF2N2O3PS/c1-4(16)14-9-15-7-2-5(10(12,13)19(17)18)6(11)3-8(7)20-9/h2-3,17-18H,1H3,(H,14,15,16).
What are the key properties of [(2-acetamido-6-bromo-1,3-benzothiazol-5-yl)-difluoromethyl]phosphonous acid?
[(2-acetamido-6-bromo-1,3-benzothiazol-5-yl)-difluoromethyl]phosphonous acid has a molecular weight of 385.13 g/mol, XLogP of 3.36, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2-acetamido-6-bromo-1,3-benzothiazol-5-yl)-difluoromethyl]phosphonous acid is sourced from PubChem (CID 162604049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).