C11H14F4O2U — CID 162604224
3-but-2-enyl-2,2,5,5-tetrafluoro-4-methylcyclopent-3-ene-1,1-diol;carbanide;uranium(2+) (PubChem CID 162604224) has the molecular formula C11H14F4O2U and a molecular weight of 492.25 g/mol. Its IUPAC name is 3-but-2-enyl-2,2,5,5-tetrafluoro-4-methylcyclopent-3-ene-1,1-diol;carbanide;uranium(2+).
| Compound Name | 3-but-2-enyl-2,2,5,5-tetrafluoro-4-methylcyclopent-3-ene-1,1-diol;carbanide;uranium(2+) |
|---|---|
| PubChem CID | 162604224 |
| Molecular Formula | C11H14F4O2U |
| Molecular Weight | 492.25 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | 3-but-2-enyl-2,2,5,5-tetrafluoro-4-methylcyclopent-3-ene-1,1-diol;carbanide;uranium(2+) |
| SMILES | C/[C-]=C\CC1=C(C)C(F)(F)C(O)(O)C1(F)F.[CH3-].[U+2] |
| InChI | InChI=1S/C10H11F4O2.CH3.U/c1-3-4-5-7-6(2)8(11,12)10(15,16)9(7,13)14;;/h4,15-16H,5H2,1-2H3;1H3;/q2*-1;+2 |
| InChIKey | ZOECSJVGTQOZSW-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.25 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|