C10H12F4O2 — CID 162604526
2,2,3,3-tetrafluoro-4a,6-dimethyl-8,8a-dihydro-7H-1,4-benzodioxine (PubChem CID 162604526) has the molecular formula C10H12F4O2 and a molecular weight of 240.20 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-4a,6-dimethyl-8,8a-dihydro-7H-1,4-benzodioxine.
| Compound Name | 2,2,3,3-tetrafluoro-4a,6-dimethyl-8,8a-dihydro-7H-1,4-benzodioxine |
|---|---|
| PubChem CID | 162604526 |
| Molecular Formula | C10H12F4O2 |
| Molecular Weight | 240.20 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 2,2,3,3-tetrafluoro-4a,6-dimethyl-8,8a-dihydro-7H-1,4-benzodioxine |
| SMILES | CC1=CC2(C)OC(F)(F)C(F)(F)OC2CC1 |
| InChI | InChI=1S/C10H12F4O2/c1-6-3-4-7-8(2,5-6)16-10(13,14)9(11,12)15-7/h5,7H,3-4H2,1-2H3 |
| InChIKey | MRHKAFRBQUEDPV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.20 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|