C22H21F3N2OS — CID 162604993
[2-methyl-4-[1-[4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]propoxy]phenyl]methanimine (PubChem CID 162604993) has the molecular formula C22H21F3N2OS and a molecular weight of 418.48 g/mol. Its IUPAC name is [2-methyl-4-[1-[4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]propoxy]phenyl]methanimine.
| Compound Name | [2-methyl-4-[1-[4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]propoxy]phenyl]methanimine |
|---|---|
| PubChem CID | 162604993 |
| Molecular Formula | C22H21F3N2OS |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | [2-methyl-4-[1-[4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]propoxy]phenyl]methanimine |
| SMILES | [H]/N=C/c1ccc(OC(CC)c2sc(-c3ccc(C(F)(F)F)cc3)nc2C)cc1C |
| InChI | InChI=1S/C22H21F3N2OS/c1-4-19(28-18-10-7-16(12-26)13(2)11-18)20-14(3)27-21(29-20)15-5-8-17(9-6-15)22(23,24)25/h5-12,19,26H,4H2,1-3H3/b26-12+ |
| InChIKey | CPOMQLSRRPTTNI-RPPGKUMJSA-N |
| XLogP | 6.97 |
| TPSA | 45.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|