About (Z)-2,3-dimethyl-1-[4-(trifluoromethyl)piperidin-1-yl]pent-2-en-1-one
(Z)-2,3-dimethyl-1-[4-(trifluoromethyl)piperidin-1-yl]pent-2-en-1-one (PubChem CID 162605002) has the molecular formula C13H20F3NO
and a molecular weight of 263.30 g/mol. Its IUPAC name is (Z)-2,3-dimethyl-1-[4-(trifluoromethyl)piperidin-1-yl]pent-2-en-1-one.
Molecular Properties
| Compound Name | (Z)-2,3-dimethyl-1-[4-(trifluoromethyl)piperidin-1-yl]pent-2-en-1-one |
| PubChem CID | 162605002 |
| Molecular Formula | C13H20F3NO |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | (Z)-2,3-dimethyl-1-[4-(trifluoromethyl)piperidin-1-yl]pent-2-en-1-one |
| SMILES | CC/C(C)=C(/C)C(=O)N1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H20F3NO/c1-4-9(2)10(3)12(18)17-7-5-11(6-8-17)13(14,15)16/h11H,4-8H2,1-3H3/b10-9- |
| InChIKey | SFCAUWFCDDNOBA-KTKRTIGZSA-N |
| XLogP | 3.53 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2,3-dimethyl-1-[4-(trifluoromethyl)piperidin-1-yl]pent-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2,3-dimethyl-1-[4-(trifluoromethyl)piperidin-1-yl]pent-2-en-1-one?
The IUPAC name of (Z)-2,3-dimethyl-1-[4-(trifluoromethyl)piperidin-1-yl]pent-2-en-1-one (CID 162605002) is (Z)-2,3-dimethyl-1-[4-(trifluoromethyl)piperidin-1-yl]pent-2-en-1-one.
What is the SMILES notation for (Z)-2,3-dimethyl-1-[4-(trifluoromethyl)piperidin-1-yl]pent-2-en-1-one?
The canonical SMILES for (Z)-2,3-dimethyl-1-[4-(trifluoromethyl)piperidin-1-yl]pent-2-en-1-one is CC/C(C)=C(/C)C(=O)N1CCC(C(F)(F)F)CC1.
What is the InChIKey of (Z)-2,3-dimethyl-1-[4-(trifluoromethyl)piperidin-1-yl]pent-2-en-1-one?
The InChIKey is SFCAUWFCDDNOBA-KTKRTIGZSA-N. The full InChI is InChI=1S/C13H20F3NO/c1-4-9(2)10(3)12(18)17-7-5-11(6-8-17)13(14,15)16/h11H,4-8H2,1-3H3/b10-9-.
What are the key properties of (Z)-2,3-dimethyl-1-[4-(trifluoromethyl)piperidin-1-yl]pent-2-en-1-one?
(Z)-2,3-dimethyl-1-[4-(trifluoromethyl)piperidin-1-yl]pent-2-en-1-one has a molecular weight of 263.30 g/mol, XLogP of 3.53, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2,3-dimethyl-1-[4-(trifluoromethyl)piperidin-1-yl]pent-2-en-1-one is sourced from PubChem (CID 162605002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).