C29H19F3N2 — CID 162605165
[7-cyclohexa-1,5-dien-1-yl-9-phenyl-3-(trifluoromethyl)-6b,7-dihydrocyclopenta[a]acenaphthylen-8-ylidene]cyanamide (PubChem CID 162605165) has the molecular formula C29H19F3N2 and a molecular weight of 452.48 g/mol. Its IUPAC name is [7-cyclohexa-1,5-dien-1-yl-9-phenyl-3-(trifluoromethyl)-6b,7-dihydrocyclopenta[a]acenaphthylen-8-ylidene]cyanamide.
| Compound Name | [7-cyclohexa-1,5-dien-1-yl-9-phenyl-3-(trifluoromethyl)-6b,7-dihydrocyclopenta[a]acenaphthylen-8-ylidene]cyanamide |
|---|---|
| PubChem CID | 162605165 |
| Molecular Formula | C29H19F3N2 |
| Molecular Weight | 452.48 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | [7-cyclohexa-1,5-dien-1-yl-9-phenyl-3-(trifluoromethyl)-6b,7-dihydrocyclopenta[a]acenaphthylen-8-ylidene]cyanamide |
| SMILES | N#C/N=C1/C(c2ccccc2)=C2c3ccc(C(F)(F)F)c4cccc(c34)C2C1C1=CCCC=C1 |
| InChI | InChI=1S/C29H19F3N2/c30-29(31,32)22-15-14-21-25-19(22)12-7-13-20(25)26-23(17-8-3-1-4-9-17)28(34-16-33)24(27(21)26)18-10-5-2-6-11-18/h2-3,5-15,23,26H,1,4H2/b34-28+ |
| InChIKey | UIHSIUZCIYUQIB-CDSHQWRTSA-N |
| XLogP | 7.69 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.48 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|