About 5,5-difluoro-4,4-dimethyl-2-(methylamino)pentanoic acid
5,5-difluoro-4,4-dimethyl-2-(methylamino)pentanoic acid (PubChem CID 162605388) has the molecular formula C8H15F2NO2
and a molecular weight of 195.21 g/mol. Its IUPAC name is 5,5-difluoro-4,4-dimethyl-2-(methylamino)pentanoic acid.
Molecular Properties
| Compound Name | 5,5-difluoro-4,4-dimethyl-2-(methylamino)pentanoic acid |
| PubChem CID | 162605388 |
| Molecular Formula | C8H15F2NO2 |
| Molecular Weight | 195.21 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | 5,5-difluoro-4,4-dimethyl-2-(methylamino)pentanoic acid |
| SMILES | CNC(CC(C)(C)C(F)F)C(=O)O |
| InChI | InChI=1S/C8H15F2NO2/c1-8(2,7(9)10)4-5(11-3)6(12)13/h5,7,11H,4H2,1-3H3,(H,12,13) |
| InChIKey | MDXKTZJRGRBWKJ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.21 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,5-difluoro-4,4-dimethyl-2-(methylamino)pentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-difluoro-4,4-dimethyl-2-(methylamino)pentanoic acid?
The IUPAC name of 5,5-difluoro-4,4-dimethyl-2-(methylamino)pentanoic acid (CID 162605388) is 5,5-difluoro-4,4-dimethyl-2-(methylamino)pentanoic acid.
What is the SMILES notation for 5,5-difluoro-4,4-dimethyl-2-(methylamino)pentanoic acid?
The canonical SMILES for 5,5-difluoro-4,4-dimethyl-2-(methylamino)pentanoic acid is CNC(CC(C)(C)C(F)F)C(=O)O.
What is the InChIKey of 5,5-difluoro-4,4-dimethyl-2-(methylamino)pentanoic acid?
The InChIKey is MDXKTZJRGRBWKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15F2NO2/c1-8(2,7(9)10)4-5(11-3)6(12)13/h5,7,11H,4H2,1-3H3,(H,12,13).
What are the key properties of 5,5-difluoro-4,4-dimethyl-2-(methylamino)pentanoic acid?
5,5-difluoro-4,4-dimethyl-2-(methylamino)pentanoic acid has a molecular weight of 195.21 g/mol, XLogP of 1.34, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-difluoro-4,4-dimethyl-2-(methylamino)pentanoic acid is sourced from PubChem (CID 162605388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).