About (3Z)-5-methyl-3,4-bis(trifluoromethyl)hexa-3,5-dien-2-imine
(3Z)-5-methyl-3,4-bis(trifluoromethyl)hexa-3,5-dien-2-imine (PubChem CID 162605638) has the molecular formula C9H9F6N
and a molecular weight of 245.17 g/mol. Its IUPAC name is (3Z)-5-methyl-3,4-bis(trifluoromethyl)hexa-3,5-dien-2-imine.
Molecular Properties
| Compound Name | (3Z)-5-methyl-3,4-bis(trifluoromethyl)hexa-3,5-dien-2-imine |
| PubChem CID | 162605638 |
| Molecular Formula | C9H9F6N |
| Molecular Weight | 245.17 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | (3Z)-5-methyl-3,4-bis(trifluoromethyl)hexa-3,5-dien-2-imine |
| SMILES | [H]/N=C(C)/C(=C(\C(=C)C)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H9F6N/c1-4(2)6(8(10,11)12)7(5(3)16)9(13,14)15/h16H,1H2,2-3H3/b7-6-,16-5+ |
| InChIKey | GMGIABXXGDIBKG-PIEALQRTSA-N |
| XLogP | 4.02 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.17 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-5-methyl-3,4-bis(trifluoromethyl)hexa-3,5-dien-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-5-methyl-3,4-bis(trifluoromethyl)hexa-3,5-dien-2-imine?
The IUPAC name of (3Z)-5-methyl-3,4-bis(trifluoromethyl)hexa-3,5-dien-2-imine (CID 162605638) is (3Z)-5-methyl-3,4-bis(trifluoromethyl)hexa-3,5-dien-2-imine.
What is the SMILES notation for (3Z)-5-methyl-3,4-bis(trifluoromethyl)hexa-3,5-dien-2-imine?
The canonical SMILES for (3Z)-5-methyl-3,4-bis(trifluoromethyl)hexa-3,5-dien-2-imine is [H]/N=C(C)/C(=C(\C(=C)C)C(F)(F)F)C(F)(F)F.
What is the InChIKey of (3Z)-5-methyl-3,4-bis(trifluoromethyl)hexa-3,5-dien-2-imine?
The InChIKey is GMGIABXXGDIBKG-PIEALQRTSA-N. The full InChI is InChI=1S/C9H9F6N/c1-4(2)6(8(10,11)12)7(5(3)16)9(13,14)15/h16H,1H2,2-3H3/b7-6-,16-5+.
What are the key properties of (3Z)-5-methyl-3,4-bis(trifluoromethyl)hexa-3,5-dien-2-imine?
(3Z)-5-methyl-3,4-bis(trifluoromethyl)hexa-3,5-dien-2-imine has a molecular weight of 245.17 g/mol, XLogP of 4.02, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-5-methyl-3,4-bis(trifluoromethyl)hexa-3,5-dien-2-imine is sourced from PubChem (CID 162605638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).