C17H22BF3N4O4 — CID 162605690
4,4,4-trifluoro-N-[(3R)-2-hydroxy-8-[N'-[(propanoylamino)methyl]carbamimidoyl]-3,4-dihydro-1,2-benzoxaborinin-3-yl]butanamide (PubChem CID 162605690) has the molecular formula C17H22BF3N4O4 and a molecular weight of 414.19 g/mol. Its IUPAC name is 4,4,4-trifluoro-N-[(3R)-2-hydroxy-8-[N'-[(propanoylamino)methyl]carbamimidoyl]-3,4-dihydro-1,2-benzoxaborinin-3-yl]butanamide.
| Compound Name | 4,4,4-trifluoro-N-[(3R)-2-hydroxy-8-[N'-[(propanoylamino)methyl]carbamimidoyl]-3,4-dihydro-1,2-benzoxaborinin-3-yl]butanamide |
|---|---|
| PubChem CID | 162605690 |
| Molecular Formula | C17H22BF3N4O4 |
| Molecular Weight | 414.19 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 4,4,4-trifluoro-N-[(3R)-2-hydroxy-8-[N'-[(propanoylamino)methyl]carbamimidoyl]-3,4-dihydro-1,2-benzoxaborinin-3-yl]butanamide |
| SMILES | CCC(=O)NCN=C(N)c1cccc2c1OB(O)[C@@H](NC(=O)CCC(F)(F)F)C2 |
| InChI | InChI=1S/C17H22BF3N4O4/c1-2-13(26)23-9-24-16(22)11-5-3-4-10-8-12(18(28)29-15(10)11)25-14(27)6-7-17(19,20)21/h3-5,12,28H,2,6-9H2,1H3,(H2,22,24)(H,23,26)(H,25,27)/t12-/m0/s1 |
| InChIKey | OJIQJZYIDFHOLO-LBPRGKRZSA-N |
| XLogP | 0.66 |
| TPSA | 126.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.19 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|