C25H19F6NO5S — CID 162606041
(6-butyl-14-oxo-11-oxa-13-azatetracyclo[7.5.1.05,15.010,12]pentadeca-1,3,5,7,9(15)-pentaen-13-yl) 3,5-bis(trifluoromethyl)benzenesulfonate (PubChem CID 162606041) has the molecular formula C25H19F6NO5S and a molecular weight of 559.48 g/mol. Its IUPAC name is (6-butyl-14-oxo-11-oxa-13-azatetracyclo[7.5.1.05,15.010,12]pentadeca-1,3,5,7,9(15)-pentaen-13-yl) 3,5-bis(trifluoromethyl)benzenesulfonate.
| Compound Name | (6-butyl-14-oxo-11-oxa-13-azatetracyclo[7.5.1.05,15.010,12]pentadeca-1,3,5,7,9(15)-pentaen-13-yl) 3,5-bis(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 162606041 |
| Molecular Formula | C25H19F6NO5S |
| Molecular Weight | 559.48 g/mol |
| Exact Mass | 559.09 |
| IUPAC Name | (6-butyl-14-oxo-11-oxa-13-azatetracyclo[7.5.1.05,15.010,12]pentadeca-1,3,5,7,9(15)-pentaen-13-yl) 3,5-bis(trifluoromethyl)benzenesulfonate |
| SMILES | CCCCc1ccc2c3c(cccc13)C(=O)N(OS(=O)(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)C1OC21 |
| InChI | InChI=1S/C25H19F6NO5S/c1-2-3-5-13-8-9-18-20-17(13)6-4-7-19(20)22(33)32(23-21(18)36-23)37-38(34,35)16-11-14(24(26,27)28)10-15(12-16)25(29,30)31/h4,6-12,21,23H,2-3,5H2,1H3 |
| InChIKey | ZQAGELUUJFQFAG-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 76.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.48 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|