C23H21F7N6O2 — CID 162606162
2-cyano-N-cyclopropyl-5-[1-[C-[1-(difluoromethoxy)-3,3,4,4,4-pentafluoro-2-(methylamino)but-1-enyl]-N-methylcarbonimidoyl]pyrazol-4-yl]-N-methylbenzamide (PubChem CID 162606162) has the molecular formula C23H21F7N6O2 and a molecular weight of 546.45 g/mol. Its IUPAC name is 2-cyano-N-cyclopropyl-5-[1-[C-[1-(difluoromethoxy)-3,3,4,4,4-pentafluoro-2-(methylamino)but-1-enyl]-N-methylcarbonimidoyl]pyrazol-4-yl]-N-methylbenzamide.
| Compound Name | 2-cyano-N-cyclopropyl-5-[1-[C-[1-(difluoromethoxy)-3,3,4,4,4-pentafluoro-2-(methylamino)but-1-enyl]-N-methylcarbonimidoyl]pyrazol-4-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 162606162 |
| Molecular Formula | C23H21F7N6O2 |
| Molecular Weight | 546.45 g/mol |
| Exact Mass | 546.16 |
| IUPAC Name | 2-cyano-N-cyclopropyl-5-[1-[C-[1-(difluoromethoxy)-3,3,4,4,4-pentafluoro-2-(methylamino)but-1-enyl]-N-methylcarbonimidoyl]pyrazol-4-yl]-N-methylbenzamide |
| SMILES | C/N=C(/C(OC(F)F)=C(NC)C(F)(F)C(F)(F)F)n1cc(-c2ccc(C#N)c(C(=O)N(C)C3CC3)c2)cn1 |
| InChI | InChI=1S/C23H21F7N6O2/c1-32-18(22(26,27)23(28,29)30)17(38-21(24)25)19(33-2)36-11-14(10-34-36)12-4-5-13(9-31)16(8-12)20(37)35(3)15-6-7-15/h4-5,8,10-11,15,21,32H,6-7H2,1-3H3/b18-17?,33-19- |
| InChIKey | BGNVGIGHEVKLRP-HXGXLMQNSA-N |
| XLogP | 4.40 |
| TPSA | 95.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.45 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|