About 2-[hydroxy(trifluoromethylsulfanyl)amino]propyl adamantane-1-carboxylate
2-[hydroxy(trifluoromethylsulfanyl)amino]propyl adamantane-1-carboxylate (PubChem CID 162606444) has the molecular formula C15H22F3NO3S
and a molecular weight of 353.41 g/mol. Its IUPAC name is 2-[hydroxy(trifluoromethylsulfanyl)amino]propyl adamantane-1-carboxylate.
Molecular Properties
| Compound Name | 2-[hydroxy(trifluoromethylsulfanyl)amino]propyl adamantane-1-carboxylate |
| PubChem CID | 162606444 |
| Molecular Formula | C15H22F3NO3S |
| Molecular Weight | 353.41 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 2-[hydroxy(trifluoromethylsulfanyl)amino]propyl adamantane-1-carboxylate |
| SMILES | CC(COC(=O)C12CC3CC(CC(C3)C1)C2)N(O)SC(F)(F)F |
| InChI | InChI=1S/C15H22F3NO3S/c1-9(19(21)23-15(16,17)18)8-22-13(20)14-5-10-2-11(6-14)4-12(3-10)7-14/h9-12,21H,2-8H2,1H3 |
| InChIKey | XTSDVDDRWWJRRI-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.41 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[hydroxy(trifluoromethylsulfanyl)amino]propyl adamantane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[hydroxy(trifluoromethylsulfanyl)amino]propyl adamantane-1-carboxylate?
The IUPAC name of 2-[hydroxy(trifluoromethylsulfanyl)amino]propyl adamantane-1-carboxylate (CID 162606444) is 2-[hydroxy(trifluoromethylsulfanyl)amino]propyl adamantane-1-carboxylate.
What is the SMILES notation for 2-[hydroxy(trifluoromethylsulfanyl)amino]propyl adamantane-1-carboxylate?
The canonical SMILES for 2-[hydroxy(trifluoromethylsulfanyl)amino]propyl adamantane-1-carboxylate is CC(COC(=O)C12CC3CC(CC(C3)C1)C2)N(O)SC(F)(F)F.
What is the InChIKey of 2-[hydroxy(trifluoromethylsulfanyl)amino]propyl adamantane-1-carboxylate?
The InChIKey is XTSDVDDRWWJRRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22F3NO3S/c1-9(19(21)23-15(16,17)18)8-22-13(20)14-5-10-2-11(6-14)4-12(3-10)7-14/h9-12,21H,2-8H2,1H3.
What are the key properties of 2-[hydroxy(trifluoromethylsulfanyl)amino]propyl adamantane-1-carboxylate?
2-[hydroxy(trifluoromethylsulfanyl)amino]propyl adamantane-1-carboxylate has a molecular weight of 353.41 g/mol, XLogP of 3.99, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[hydroxy(trifluoromethylsulfanyl)amino]propyl adamantane-1-carboxylate is sourced from PubChem (CID 162606444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).