C16H18F3N3 — CID 162606668
2-[4-(methylideneamino)-1-[[4-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]acetonitrile (PubChem CID 162606668) has the molecular formula C16H18F3N3 and a molecular weight of 309.33 g/mol. Its IUPAC name is 2-[4-(methylideneamino)-1-[[4-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]acetonitrile.
| Compound Name | 2-[4-(methylideneamino)-1-[[4-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]acetonitrile |
|---|---|
| PubChem CID | 162606668 |
| Molecular Formula | C16H18F3N3 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 2-[4-(methylideneamino)-1-[[4-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]acetonitrile |
| SMILES | C=NC1(CC#N)CCN(Cc2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C16H18F3N3/c1-21-15(6-9-20)7-10-22(11-8-15)12-13-2-4-14(5-3-13)16(17,18)19/h2-5H,1,6-8,10-12H2 |
| InChIKey | ZPXNZLGIJVQXPG-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 39.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|