C8H13F2NO2 — CID 162606685
6,6-difluoro-3,3-dimethyl-4-oxido-1,5,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-4-ium (PubChem CID 162606685) has the molecular formula C8H13F2NO2 and a molecular weight of 193.19 g/mol. Its IUPAC name is 6,6-difluoro-3,3-dimethyl-4-oxido-1,5,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-4-ium.
| Compound Name | 6,6-difluoro-3,3-dimethyl-4-oxido-1,5,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-4-ium |
|---|---|
| PubChem CID | 162606685 |
| Molecular Formula | C8H13F2NO2 |
| Molecular Weight | 193.19 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 6,6-difluoro-3,3-dimethyl-4-oxido-1,5,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-4-ium |
| SMILES | CC1(C)OCC2CC(F)(F)C[N+]21[O-] |
| InChI | InChI=1S/C8H13F2NO2/c1-7(2)11(12)5-8(9,10)3-6(11)4-13-7/h6H,3-5H2,1-2H3 |
| InChIKey | IARIPVAOJXEDEH-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.19 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|