C18H21F3N4O — CID 162606777
(3-amino-5,5-difluoro-1-methyl-4,6,7,7a-tetrahydroindazol-2-yl)-(6-fluoro-1,2,3,4-tetrahydroquinolin-4-yl)methanone (PubChem CID 162606777) has the molecular formula C18H21F3N4O and a molecular weight of 366.39 g/mol. Its IUPAC name is (3-amino-5,5-difluoro-1-methyl-4,6,7,7a-tetrahydroindazol-2-yl)-(6-fluoro-1,2,3,4-tetrahydroquinolin-4-yl)methanone.
| Compound Name | (3-amino-5,5-difluoro-1-methyl-4,6,7,7a-tetrahydroindazol-2-yl)-(6-fluoro-1,2,3,4-tetrahydroquinolin-4-yl)methanone |
|---|---|
| PubChem CID | 162606777 |
| Molecular Formula | C18H21F3N4O |
| Molecular Weight | 366.39 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | (3-amino-5,5-difluoro-1-methyl-4,6,7,7a-tetrahydroindazol-2-yl)-(6-fluoro-1,2,3,4-tetrahydroquinolin-4-yl)methanone |
| SMILES | CN1C2CCC(F)(F)CC2=C(N)N1C(=O)C1CCNc2ccc(F)cc21 |
| InChI | InChI=1S/C18H21F3N4O/c1-24-15-4-6-18(20,21)9-13(15)16(22)25(24)17(26)11-5-7-23-14-3-2-10(19)8-12(11)14/h2-3,8,11,15,23H,4-7,9,22H2,1H3 |
| InChIKey | ZMVXTORQARDIOU-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.39 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |