C20H25F2N3O3 — CID 162606849
methyl 2-[5-[3-(4,4-difluoropiperidin-1-yl)propoxy]-2-pyridinyl]-2,3-dihydropyridine-4-carboxylate (PubChem CID 162606849) has the molecular formula C20H25F2N3O3 and a molecular weight of 393.43 g/mol. Its IUPAC name is methyl 2-[5-[3-(4,4-difluoropiperidin-1-yl)propoxy]-2-pyridinyl]-2,3-dihydropyridine-4-carboxylate.
| Compound Name | methyl 2-[5-[3-(4,4-difluoropiperidin-1-yl)propoxy]-2-pyridinyl]-2,3-dihydropyridine-4-carboxylate |
|---|---|
| PubChem CID | 162606849 |
| Molecular Formula | C20H25F2N3O3 |
| Molecular Weight | 393.43 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | methyl 2-[5-[3-(4,4-difluoropiperidin-1-yl)propoxy]-2-pyridinyl]-2,3-dihydropyridine-4-carboxylate |
| SMILES | COC(=O)C1=CC=NC(c2ccc(OCCCN3CCC(F)(F)CC3)cn2)C1 |
| InChI | InChI=1S/C20H25F2N3O3/c1-27-19(26)15-5-8-23-18(13-15)17-4-3-16(14-24-17)28-12-2-9-25-10-6-20(21,22)7-11-25/h3-5,8,14,18H,2,6-7,9-13H2,1H3 |
| InChIKey | ZUSUSHMIYLMKLC-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 64.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.43 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|