About (1Z,5Z)-5-(difluoromethyl)-1-fluoro-2-iodohepta-1,5-diene
(1Z,5Z)-5-(difluoromethyl)-1-fluoro-2-iodohepta-1,5-diene (PubChem CID 162607400) has the molecular formula C8H10F3I
and a molecular weight of 290.07 g/mol. Its IUPAC name is (1Z,5Z)-5-(difluoromethyl)-1-fluoro-2-iodohepta-1,5-diene.
Molecular Properties
| Compound Name | (1Z,5Z)-5-(difluoromethyl)-1-fluoro-2-iodohepta-1,5-diene |
| PubChem CID | 162607400 |
| Molecular Formula | C8H10F3I |
| Molecular Weight | 290.07 g/mol |
| Exact Mass | 289.98 |
| IUPAC Name | (1Z,5Z)-5-(difluoromethyl)-1-fluoro-2-iodohepta-1,5-diene |
| SMILES | C/C=C(/CC/C(I)=C/F)C(F)F |
| InChI | InChI=1S/C8H10F3I/c1-2-6(8(10)11)3-4-7(12)5-9/h2,5,8H,3-4H2,1H3/b6-2-,7-5- |
| InChIKey | MJGLKZCQJGRKPY-QOXGDRCISA-N |
| XLogP | 4.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.07 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1Z,5Z)-5-(difluoromethyl)-1-fluoro-2-iodohepta-1,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z,5Z)-5-(difluoromethyl)-1-fluoro-2-iodohepta-1,5-diene?
The IUPAC name of (1Z,5Z)-5-(difluoromethyl)-1-fluoro-2-iodohepta-1,5-diene (CID 162607400) is (1Z,5Z)-5-(difluoromethyl)-1-fluoro-2-iodohepta-1,5-diene.
What is the SMILES notation for (1Z,5Z)-5-(difluoromethyl)-1-fluoro-2-iodohepta-1,5-diene?
The canonical SMILES for (1Z,5Z)-5-(difluoromethyl)-1-fluoro-2-iodohepta-1,5-diene is C/C=C(/CC/C(I)=C/F)C(F)F.
What is the InChIKey of (1Z,5Z)-5-(difluoromethyl)-1-fluoro-2-iodohepta-1,5-diene?
The InChIKey is MJGLKZCQJGRKPY-QOXGDRCISA-N. The full InChI is InChI=1S/C8H10F3I/c1-2-6(8(10)11)3-4-7(12)5-9/h2,5,8H,3-4H2,1H3/b6-2-,7-5-.
What are the key properties of (1Z,5Z)-5-(difluoromethyl)-1-fluoro-2-iodohepta-1,5-diene?
(1Z,5Z)-5-(difluoromethyl)-1-fluoro-2-iodohepta-1,5-diene has a molecular weight of 290.07 g/mol, XLogP of 4.22, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z,5Z)-5-(difluoromethyl)-1-fluoro-2-iodohepta-1,5-diene is sourced from PubChem (CID 162607400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).