C10H14F5N — CID 162607539
1-(1,1,2,3,3-pentafluorohex-5-enyl)pyrrolidine (PubChem CID 162607539) has the molecular formula C10H14F5N and a molecular weight of 243.22 g/mol. Its IUPAC name is 1-(1,1,2,3,3-pentafluorohex-5-enyl)pyrrolidine.
| Compound Name | 1-(1,1,2,3,3-pentafluorohex-5-enyl)pyrrolidine |
|---|---|
| PubChem CID | 162607539 |
| Molecular Formula | C10H14F5N |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 1-(1,1,2,3,3-pentafluorohex-5-enyl)pyrrolidine |
| SMILES | C=CCC(F)(F)C(F)C(F)(F)N1CCCC1 |
| InChI | InChI=1S/C10H14F5N/c1-2-5-9(12,13)8(11)10(14,15)16-6-3-4-7-16/h2,8H,1,3-7H2 |
| InChIKey | XXHSQCSKBAVHOV-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|