C13H14F3N3O3S — CID 162608100
1-[5-[(3-amino-4,4,4-trifluorobut-2-enylidene)amino]-3-ethylsulfonyl-2-pyridinyl]ethanone (PubChem CID 162608100) has the molecular formula C13H14F3N3O3S and a molecular weight of 349.33 g/mol. Its IUPAC name is 1-[5-[(3-amino-4,4,4-trifluorobut-2-enylidene)amino]-3-ethylsulfonyl-2-pyridinyl]ethanone.
| Compound Name | 1-[5-[(3-amino-4,4,4-trifluorobut-2-enylidene)amino]-3-ethylsulfonyl-2-pyridinyl]ethanone |
|---|---|
| PubChem CID | 162608100 |
| Molecular Formula | C13H14F3N3O3S |
| Molecular Weight | 349.33 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 1-[5-[(3-amino-4,4,4-trifluorobut-2-enylidene)amino]-3-ethylsulfonyl-2-pyridinyl]ethanone |
| SMILES | CCS(=O)(=O)c1cc(/N=C/C=C(N)C(F)(F)F)cnc1C(C)=O |
| InChI | InChI=1S/C13H14F3N3O3S/c1-3-23(21,22)10-6-9(7-19-12(10)8(2)20)18-5-4-11(17)13(14,15)16/h4-7H,3,17H2,1-2H3/b11-4?,18-5+ |
| InChIKey | MOCFGAMGXKKTFY-RTIGFQSASA-N |
| XLogP | 2.18 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.33 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|