C16H12F3N — CID 162608105
3-methylidene-15-(trifluoromethyl)-1-azatetracyclo[9.4.0.02,4.05,10]pentadeca-6,8,10,12,14-pentaene (PubChem CID 162608105) has the molecular formula C16H12F3N and a molecular weight of 275.27 g/mol. Its IUPAC name is 3-methylidene-15-(trifluoromethyl)-1-azatetracyclo[9.4.0.02,4.05,10]pentadeca-6,8,10,12,14-pentaene.
| Compound Name | 3-methylidene-15-(trifluoromethyl)-1-azatetracyclo[9.4.0.02,4.05,10]pentadeca-6,8,10,12,14-pentaene |
|---|---|
| PubChem CID | 162608105 |
| Molecular Formula | C16H12F3N |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 3-methylidene-15-(trifluoromethyl)-1-azatetracyclo[9.4.0.02,4.05,10]pentadeca-6,8,10,12,14-pentaene |
| SMILES | C=C1C2C3C=CC=CC3=C3C=CC=C(C(F)(F)F)N3C12 |
| InChI | InChI=1S/C16H12F3N/c1-9-14-11-6-3-2-5-10(11)12-7-4-8-13(16(17,18)19)20(12)15(9)14/h2-8,11,14-15H,1H2 |
| InChIKey | KGWPDQNUXXIDFV-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|