C9H14F4O — CID 162608292
3-fluoro-2,3-dimethyl-5-(2,2,2-trifluoroethoxy)pent-1-ene (PubChem CID 162608292) has the molecular formula C9H14F4O and a molecular weight of 214.20 g/mol. Its IUPAC name is 3-fluoro-2,3-dimethyl-5-(2,2,2-trifluoroethoxy)pent-1-ene.
| Compound Name | 3-fluoro-2,3-dimethyl-5-(2,2,2-trifluoroethoxy)pent-1-ene |
|---|---|
| PubChem CID | 162608292 |
| Molecular Formula | C9H14F4O |
| Molecular Weight | 214.20 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 3-fluoro-2,3-dimethyl-5-(2,2,2-trifluoroethoxy)pent-1-ene |
| SMILES | C=C(C)C(C)(F)CCOCC(F)(F)F |
| InChI | InChI=1S/C9H14F4O/c1-7(2)8(3,10)4-5-14-6-9(11,12)13/h1,4-6H2,2-3H3 |
| InChIKey | XUGXBQZCGOPGQT-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.20 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|