C43H17F15N4 — CID 162609082
3,5-bis[2,7-bis(trifluoromethyl)carbazol-9-yl]-4-[2-cyano-4-(trifluoromethyl)phenyl]benzonitrile (PubChem CID 162609082) has the molecular formula C43H17F15N4 and a molecular weight of 874.61 g/mol. Its IUPAC name is 3,5-bis[2,7-bis(trifluoromethyl)carbazol-9-yl]-4-[2-cyano-4-(trifluoromethyl)phenyl]benzonitrile.
| Compound Name | 3,5-bis[2,7-bis(trifluoromethyl)carbazol-9-yl]-4-[2-cyano-4-(trifluoromethyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 162609082 |
| Molecular Formula | C43H17F15N4 |
| Molecular Weight | 874.61 g/mol |
| Exact Mass | 874.12 |
| IUPAC Name | 3,5-bis[2,7-bis(trifluoromethyl)carbazol-9-yl]-4-[2-cyano-4-(trifluoromethyl)phenyl]benzonitrile |
| SMILES | N#Cc1cc(-n2c3cc(C(F)(F)F)ccc3c3ccc(C(F)(F)F)cc32)c(-c2ccc(C(F)(F)F)cc2C#N)c(-n2c3cc(C(F)(F)F)ccc3c3ccc(C(F)(F)F)cc32)c1 |
| InChI | InChI=1S/C43H17F15N4/c44-39(45,46)22-1-6-27(21(13-22)19-60)38-36(61-32-14-23(40(47,48)49)2-7-28(32)29-8-3-24(15-33(29)61)41(50,51)52)11-20(18-59)12-37(38)62-34-16-25(42(53,54)55)4-9-30(34)31-10-5-26(17-35(31)62)43(56,57)58/h1-17H |
| InChIKey | DDVHHFJZVRLXHQ-UHFFFAOYSA-N |
| XLogP | 14.39 |
| TPSA | 57.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 874.61 |
| LogP ≤ 5 | 14.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |