C6H7F3N2O4 — CID 162609219
4,4,4-trifluoro-3,3-dimethoxy-2-nitrobutanenitrile (PubChem CID 162609219) has the molecular formula C6H7F3N2O4 and a molecular weight of 228.13 g/mol. Its IUPAC name is 4,4,4-trifluoro-3,3-dimethoxy-2-nitrobutanenitrile.
| Compound Name | 4,4,4-trifluoro-3,3-dimethoxy-2-nitrobutanenitrile |
|---|---|
| PubChem CID | 162609219 |
| Molecular Formula | C6H7F3N2O4 |
| Molecular Weight | 228.13 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | 4,4,4-trifluoro-3,3-dimethoxy-2-nitrobutanenitrile |
| SMILES | COC(OC)(C(C#N)[N+](=O)[O-])C(F)(F)F |
| InChI | InChI=1S/C6H7F3N2O4/c1-14-5(15-2,6(7,8)9)4(3-10)11(12)13/h4H,1-2H3 |
| InChIKey | NSRBFQAVEIGLIU-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 85.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.13 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|