C18H14F4N6S — CID 162609538
5-fluoro-9-methylsulfanyl-7-[5-(trifluoromethyl)-1H-pyrazol-4-yl]-3,8,10,11-tetrahydroindazolo[5,4-c][2,7]naphthyridine (PubChem CID 162609538) has the molecular formula C18H14F4N6S and a molecular weight of 422.41 g/mol. Its IUPAC name is 5-fluoro-9-methylsulfanyl-7-[5-(trifluoromethyl)-1H-pyrazol-4-yl]-3,8,10,11-tetrahydroindazolo[5,4-c][2,7]naphthyridine.
| Compound Name | 5-fluoro-9-methylsulfanyl-7-[5-(trifluoromethyl)-1H-pyrazol-4-yl]-3,8,10,11-tetrahydroindazolo[5,4-c][2,7]naphthyridine |
|---|---|
| PubChem CID | 162609538 |
| Molecular Formula | C18H14F4N6S |
| Molecular Weight | 422.41 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | 5-fluoro-9-methylsulfanyl-7-[5-(trifluoromethyl)-1H-pyrazol-4-yl]-3,8,10,11-tetrahydroindazolo[5,4-c][2,7]naphthyridine |
| SMILES | CSN1CCc2c(c(-c3cn[nH]c3C(F)(F)F)nc3c(F)cc4[nH]ncc4c23)C1 |
| InChI | InChI=1S/C18H14F4N6S/c1-29-28-3-2-8-11(7-28)15(10-6-24-27-17(10)18(20,21)22)25-16-12(19)4-13-9(14(8)16)5-23-26-13/h4-6H,2-3,7H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | HJKRIOAZCWKADL-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 73.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.41 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|