C9H13F3N2O3S2 — CID 162609893
1,1,1-trifluoro-N-[[(2E,4E)-5-methylhepta-2,4,6-trien-2-yl]sulfonimidoyl]methanesulfonamide (PubChem CID 162609893) has the molecular formula C9H13F3N2O3S2 and a molecular weight of 318.34 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-[[(2E,4E)-5-methylhepta-2,4,6-trien-2-yl]sulfonimidoyl]methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-[[(2E,4E)-5-methylhepta-2,4,6-trien-2-yl]sulfonimidoyl]methanesulfonamide |
|---|---|
| PubChem CID | 162609893 |
| Molecular Formula | C9H13F3N2O3S2 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | 1,1,1-trifluoro-N-[[(2E,4E)-5-methylhepta-2,4,6-trien-2-yl]sulfonimidoyl]methanesulfonamide |
| SMILES | [H]N=S(=O)(NS(=O)(=O)C(F)(F)F)/C(C)=C/C=C(\C)C=C |
| InChI | InChI=1S/C9H13F3N2O3S2/c1-4-7(2)5-6-8(3)18(13,15)14-19(16,17)9(10,11)12/h4-6H,1H2,2-3H3,(H2,13,14,15)/b7-5+,8-6+ |
| InChIKey | DVTRCXHAUOYXAR-KQQUZDAGSA-N |
| XLogP | 2.42 |
| TPSA | 87.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|