About 2-[3-methyl-5,5-bis(trifluoromethyl)oxolan-2-yl]oxyethyl 2,2-dimethylpropanoate
2-[3-methyl-5,5-bis(trifluoromethyl)oxolan-2-yl]oxyethyl 2,2-dimethylpropanoate (PubChem CID 162610371) has the molecular formula C14H20F6O4
and a molecular weight of 366.30 g/mol. Its IUPAC name is 2-[3-methyl-5,5-bis(trifluoromethyl)oxolan-2-yl]oxyethyl 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | 2-[3-methyl-5,5-bis(trifluoromethyl)oxolan-2-yl]oxyethyl 2,2-dimethylpropanoate |
| PubChem CID | 162610371 |
| Molecular Formula | C14H20F6O4 |
| Molecular Weight | 366.30 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 2-[3-methyl-5,5-bis(trifluoromethyl)oxolan-2-yl]oxyethyl 2,2-dimethylpropanoate |
| SMILES | CC1CC(C(F)(F)F)(C(F)(F)F)OC1OCCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C14H20F6O4/c1-8-7-12(13(15,16)17,14(18,19)20)24-9(8)22-5-6-23-10(21)11(2,3)4/h8-9H,5-7H2,1-4H3 |
| InChIKey | NVQMHBXKBGKPTG-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.30 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-methyl-5,5-bis(trifluoromethyl)oxolan-2-yl]oxyethyl 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-methyl-5,5-bis(trifluoromethyl)oxolan-2-yl]oxyethyl 2,2-dimethylpropanoate?
The IUPAC name of 2-[3-methyl-5,5-bis(trifluoromethyl)oxolan-2-yl]oxyethyl 2,2-dimethylpropanoate (CID 162610371) is 2-[3-methyl-5,5-bis(trifluoromethyl)oxolan-2-yl]oxyethyl 2,2-dimethylpropanoate.
What is the SMILES notation for 2-[3-methyl-5,5-bis(trifluoromethyl)oxolan-2-yl]oxyethyl 2,2-dimethylpropanoate?
The canonical SMILES for 2-[3-methyl-5,5-bis(trifluoromethyl)oxolan-2-yl]oxyethyl 2,2-dimethylpropanoate is CC1CC(C(F)(F)F)(C(F)(F)F)OC1OCCOC(=O)C(C)(C)C.
What is the InChIKey of 2-[3-methyl-5,5-bis(trifluoromethyl)oxolan-2-yl]oxyethyl 2,2-dimethylpropanoate?
The InChIKey is NVQMHBXKBGKPTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20F6O4/c1-8-7-12(13(15,16)17,14(18,19)20)24-9(8)22-5-6-23-10(21)11(2,3)4/h8-9H,5-7H2,1-4H3.
What are the key properties of 2-[3-methyl-5,5-bis(trifluoromethyl)oxolan-2-yl]oxyethyl 2,2-dimethylpropanoate?
2-[3-methyl-5,5-bis(trifluoromethyl)oxolan-2-yl]oxyethyl 2,2-dimethylpropanoate has a molecular weight of 366.30 g/mol, XLogP of 3.84, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-methyl-5,5-bis(trifluoromethyl)oxolan-2-yl]oxyethyl 2,2-dimethylpropanoate is sourced from PubChem (CID 162610371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).