C11H19F3N2 — CID 162611633
1-[(3S,4E)-2,5-dimethyl-4-(trifluoromethyl)hepta-4,6-dien-3-yl]-2-methylhydrazine (PubChem CID 162611633) has the molecular formula C11H19F3N2 and a molecular weight of 236.28 g/mol. Its IUPAC name is 1-[(3S,4E)-2,5-dimethyl-4-(trifluoromethyl)hepta-4,6-dien-3-yl]-2-methylhydrazine.
| Compound Name | 1-[(3S,4E)-2,5-dimethyl-4-(trifluoromethyl)hepta-4,6-dien-3-yl]-2-methylhydrazine |
|---|---|
| PubChem CID | 162611633 |
| Molecular Formula | C11H19F3N2 |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 1-[(3S,4E)-2,5-dimethyl-4-(trifluoromethyl)hepta-4,6-dien-3-yl]-2-methylhydrazine |
| SMILES | C=C/C(C)=C(\[C@@H](NNC)C(C)C)C(F)(F)F |
| InChI | InChI=1S/C11H19F3N2/c1-6-8(4)9(11(12,13)14)10(7(2)3)16-15-5/h6-7,10,15-16H,1H2,2-5H3/b9-8+/t10-/m0/s1 |
| InChIKey | XMPMCPGNBNIFKG-DDXVTDLHSA-N |
| XLogP | 2.80 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|