C8H8F6N2 — CID 162611638
1,1,1-trifluoro-4-methylimino-5-(trifluoromethyl)hexa-2,5-dien-2-amine (PubChem CID 162611638) has the molecular formula C8H8F6N2 and a molecular weight of 246.15 g/mol. Its IUPAC name is 1,1,1-trifluoro-4-methylimino-5-(trifluoromethyl)hexa-2,5-dien-2-amine.
| Compound Name | 1,1,1-trifluoro-4-methylimino-5-(trifluoromethyl)hexa-2,5-dien-2-amine |
|---|---|
| PubChem CID | 162611638 |
| Molecular Formula | C8H8F6N2 |
| Molecular Weight | 246.15 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 1,1,1-trifluoro-4-methylimino-5-(trifluoromethyl)hexa-2,5-dien-2-amine |
| SMILES | C=C(/C(C=C(N)C(F)(F)F)=N\C)C(F)(F)F |
| InChI | InChI=1S/C8H8F6N2/c1-4(7(9,10)11)5(16-2)3-6(15)8(12,13)14/h3H,1,15H2,2H3/b6-3?,16-5- |
| InChIKey | IJAVNIFTQJDKQI-UGQPUWPYSA-N |
| XLogP | 2.58 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.15 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|