C65H38F6N6 — CID 162611736
9-[3-[2,4-bis(trifluoromethyl)phenyl]-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,6-di(carbazol-9-yl)carbazole (PubChem CID 162611736) has the molecular formula C65H38F6N6 and a molecular weight of 1017.05 g/mol. Its IUPAC name is 9-[3-[2,4-bis(trifluoromethyl)phenyl]-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,6-di(carbazol-9-yl)carbazole.
| Compound Name | 9-[3-[2,4-bis(trifluoromethyl)phenyl]-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,6-di(carbazol-9-yl)carbazole |
|---|---|
| PubChem CID | 162611736 |
| Molecular Formula | C65H38F6N6 |
| Molecular Weight | 1017.05 g/mol |
| Exact Mass | 1016.31 |
| IUPAC Name | 9-[3-[2,4-bis(trifluoromethyl)phenyl]-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,6-di(carbazol-9-yl)carbazole |
| SMILES | FC(F)(F)c1ccc(-c2cc(-n3c4ccc(-n5c6ccccc6c6ccccc65)cc4c4cc(-n5c6ccccc6c6ccccc65)ccc43)ccc2-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C65H38F6N6/c66-64(67,68)41-27-31-45(54(35-41)65(69,70)71)51-36-42(28-32-50(51)63-73-61(39-15-3-1-4-16-39)72-62(74-63)40-17-5-2-6-18-40)77-59-33-29-43(75-55-23-11-7-19-46(55)47-20-8-12-24-56(47)75)37-52(59)53-38-44(30-34-60(53)77)76-57-25-13-9-21-48(57)49-22-10-14-26-58(49)76/h1-38H |
| InChIKey | RUEHRXRRAAPKEL-UHFFFAOYSA-N |
| XLogP | 17.87 |
| TPSA | 53.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 77 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1017.05 |
| LogP ≤ 5 | 17.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |