C25H24F3N5O4 — CID 162612373
6-(3-hydroxypropyl)-2-methyl-10-[(5-methyl-3-pyridinyl)oxy]-9-[[6-(trifluoromethyl)-3-pyridinyl]methyl]-4-oxa-2,6,12-triazatricyclo[6.4.0.03,5]dodeca-1(12),8,10-trien-7-one (PubChem CID 162612373) has the molecular formula C25H24F3N5O4 and a molecular weight of 515.49 g/mol. Its IUPAC name is 6-(3-hydroxypropyl)-2-methyl-10-[(5-methyl-3-pyridinyl)oxy]-9-[[6-(trifluoromethyl)-3-pyridinyl]methyl]-4-oxa-2,6,12-triazatricyclo[6.4.0.03,5]dodeca-1(12),8,10-trien-7-one.
| Compound Name | 6-(3-hydroxypropyl)-2-methyl-10-[(5-methyl-3-pyridinyl)oxy]-9-[[6-(trifluoromethyl)-3-pyridinyl]methyl]-4-oxa-2,6,12-triazatricyclo[6.4.0.03,5]dodeca-1(12),8,10-trien-7-one |
|---|---|
| PubChem CID | 162612373 |
| Molecular Formula | C25H24F3N5O4 |
| Molecular Weight | 515.49 g/mol |
| Exact Mass | 515.18 |
| IUPAC Name | 6-(3-hydroxypropyl)-2-methyl-10-[(5-methyl-3-pyridinyl)oxy]-9-[[6-(trifluoromethyl)-3-pyridinyl]methyl]-4-oxa-2,6,12-triazatricyclo[6.4.0.03,5]dodeca-1(12),8,10-trien-7-one |
| SMILES | Cc1cncc(Oc2cnc3c(c2Cc2ccc(C(F)(F)F)nc2)C(=O)N(CCCO)C2OC2N3C)c1 |
| InChI | InChI=1S/C25H24F3N5O4/c1-14-8-16(12-29-10-14)36-18-13-31-21-20(17(18)9-15-4-5-19(30-11-15)25(26,27)28)22(35)33(6-3-7-34)24-23(37-24)32(21)2/h4-5,8,10-13,23-24,34H,3,6-7,9H2,1-2H3 |
| InChIKey | SMNVKVLXVJIRMZ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.49 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|