C12H17F6IN2O3 — CID 162612840
[4,4,4-trifluoro-3-hydroxy-2-methyl-3-(trifluoromethyl)butan-2-yl] (2S)-2-iodo-2-(2-methyl-1,3-diazetidin-2-yl)propanoate (PubChem CID 162612840) has the molecular formula C12H17F6IN2O3 and a molecular weight of 478.17 g/mol. Its IUPAC name is [4,4,4-trifluoro-3-hydroxy-2-methyl-3-(trifluoromethyl)butan-2-yl] (2S)-2-iodo-2-(2-methyl-1,3-diazetidin-2-yl)propanoate.
| Compound Name | [4,4,4-trifluoro-3-hydroxy-2-methyl-3-(trifluoromethyl)butan-2-yl] (2S)-2-iodo-2-(2-methyl-1,3-diazetidin-2-yl)propanoate |
|---|---|
| PubChem CID | 162612840 |
| Molecular Formula | C12H17F6IN2O3 |
| Molecular Weight | 478.17 g/mol |
| Exact Mass | 478.02 |
| IUPAC Name | [4,4,4-trifluoro-3-hydroxy-2-methyl-3-(trifluoromethyl)butan-2-yl] (2S)-2-iodo-2-(2-methyl-1,3-diazetidin-2-yl)propanoate |
| SMILES | CC(C)(OC(=O)[C@@](C)(I)C1(C)NCN1)C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H17F6IN2O3/c1-7(2,10(23,11(13,14)15)12(16,17)18)24-6(22)8(3,19)9(4)20-5-21-9/h20-21,23H,5H2,1-4H3/t8-/m1/s1 |
| InChIKey | XESMUNAERWEAPS-MRVPVSSYSA-N |
| XLogP | 2.22 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.17 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|