C32H43BF3NO6 — CID 162612912
methyl 2-[3-methoxy-2-(1,3,4,5-tetrahydro-2-benzoxepin-7-yl)-4-(4,4,5,5-tetramethyl-1,3,2-oxazaborolidin-2-yl)-6-(trifluoromethyl)phenyl]-3-[(2-methylpropan-2-yl)oxy]propanoate (PubChem CID 162612912) has the molecular formula C32H43BF3NO6 and a molecular weight of 605.50 g/mol. Its IUPAC name is methyl 2-[3-methoxy-2-(1,3,4,5-tetrahydro-2-benzoxepin-7-yl)-4-(4,4,5,5-tetramethyl-1,3,2-oxazaborolidin-2-yl)-6-(trifluoromethyl)phenyl]-3-[(2-methylpropan-2-yl)oxy]propanoate.
| Compound Name | methyl 2-[3-methoxy-2-(1,3,4,5-tetrahydro-2-benzoxepin-7-yl)-4-(4,4,5,5-tetramethyl-1,3,2-oxazaborolidin-2-yl)-6-(trifluoromethyl)phenyl]-3-[(2-methylpropan-2-yl)oxy]propanoate |
|---|---|
| PubChem CID | 162612912 |
| Molecular Formula | C32H43BF3NO6 |
| Molecular Weight | 605.50 g/mol |
| Exact Mass | 605.31 |
| IUPAC Name | methyl 2-[3-methoxy-2-(1,3,4,5-tetrahydro-2-benzoxepin-7-yl)-4-(4,4,5,5-tetramethyl-1,3,2-oxazaborolidin-2-yl)-6-(trifluoromethyl)phenyl]-3-[(2-methylpropan-2-yl)oxy]propanoate |
| SMILES | COC(=O)C(COC(C)(C)C)c1c(C(F)(F)F)cc(B2NC(C)(C)C(C)(C)O2)c(OC)c1-c1ccc2c(c1)CCCOC2 |
| InChI | InChI=1S/C32H43BF3NO6/c1-29(2,3)42-18-22(28(38)40-9)26-23(32(34,35)36)16-24(33-37-30(4,5)31(6,7)43-33)27(39-8)25(26)20-12-13-21-17-41-14-10-11-19(21)15-20/h12-13,15-16,22,37H,10-11,14,17-18H2,1-9H3 |
| InChIKey | VRUAIDBGAUKPFO-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.50 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|