C14H21F2N3O — CID 162613199
9,9-difluoro-6-(oxiran-2-ylmethyl)-1-propan-2-yl-5,6,7,8-tetrahydro-4H-cycloocta[d]triazole (PubChem CID 162613199) has the molecular formula C14H21F2N3O and a molecular weight of 285.34 g/mol. Its IUPAC name is 9,9-difluoro-6-(oxiran-2-ylmethyl)-1-propan-2-yl-5,6,7,8-tetrahydro-4H-cycloocta[d]triazole.
| Compound Name | 9,9-difluoro-6-(oxiran-2-ylmethyl)-1-propan-2-yl-5,6,7,8-tetrahydro-4H-cycloocta[d]triazole |
|---|---|
| PubChem CID | 162613199 |
| Molecular Formula | C14H21F2N3O |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 9,9-difluoro-6-(oxiran-2-ylmethyl)-1-propan-2-yl-5,6,7,8-tetrahydro-4H-cycloocta[d]triazole |
| SMILES | CC(C)n1nnc2c1C(F)(F)CCC(CC1CO1)CC2 |
| InChI | InChI=1S/C14H21F2N3O/c1-9(2)19-13-12(17-18-19)4-3-10(7-11-8-20-11)5-6-14(13,15)16/h9-11H,3-8H2,1-2H3 |
| InChIKey | HKLYHBUTURDXPU-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 43.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|