C26H31F4N5O — CID 162614050
3-amino-2-[(1S,3R)-1-[5-[[1-(3-fluoropropyl)azetidin-3-yl]amino]-2-pyridinyl]-3-methyl-2-(2,2,2-trifluoroethyl)-3,4-dihydro-1H-isoquinolin-6-yl]prop-2-enal (PubChem CID 162614050) has the molecular formula C26H31F4N5O and a molecular weight of 505.56 g/mol. Its IUPAC name is 3-amino-2-[(1S,3R)-1-[5-[[1-(3-fluoropropyl)azetidin-3-yl]amino]-2-pyridinyl]-3-methyl-2-(2,2,2-trifluoroethyl)-3,4-dihydro-1H-isoquinolin-6-yl]prop-2-enal.
| Compound Name | 3-amino-2-[(1S,3R)-1-[5-[[1-(3-fluoropropyl)azetidin-3-yl]amino]-2-pyridinyl]-3-methyl-2-(2,2,2-trifluoroethyl)-3,4-dihydro-1H-isoquinolin-6-yl]prop-2-enal |
|---|---|
| PubChem CID | 162614050 |
| Molecular Formula | C26H31F4N5O |
| Molecular Weight | 505.56 g/mol |
| Exact Mass | 505.25 |
| IUPAC Name | 3-amino-2-[(1S,3R)-1-[5-[[1-(3-fluoropropyl)azetidin-3-yl]amino]-2-pyridinyl]-3-methyl-2-(2,2,2-trifluoroethyl)-3,4-dihydro-1H-isoquinolin-6-yl]prop-2-enal |
| SMILES | C[C@@H]1Cc2cc(C(C=O)=CN)ccc2[C@@H](c2ccc(NC3CN(CCCF)C3)cn2)N1CC(F)(F)F |
| InChI | InChI=1S/C26H31F4N5O/c1-17-9-19-10-18(20(11-31)15-36)3-5-23(19)25(35(17)16-26(28,29)30)24-6-4-21(12-32-24)33-22-13-34(14-22)8-2-7-27/h3-6,10-12,15,17,22,25,33H,2,7-9,13-14,16,31H2,1H3/t17-,25+/m1/s1 |
| InChIKey | ACTXBRMBNDRJSL-NSYGIPOTSA-N |
| XLogP | 3.93 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.56 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|