C11H18F3N3O2 — CID 162614685
2,6-dimethyl-4-nitro-5-(2,2,2-trifluoroethylimino)hept-3-en-3-amine (PubChem CID 162614685) has the molecular formula C11H18F3N3O2 and a molecular weight of 281.28 g/mol. Its IUPAC name is 2,6-dimethyl-4-nitro-5-(2,2,2-trifluoroethylimino)hept-3-en-3-amine.
| Compound Name | 2,6-dimethyl-4-nitro-5-(2,2,2-trifluoroethylimino)hept-3-en-3-amine |
|---|---|
| PubChem CID | 162614685 |
| Molecular Formula | C11H18F3N3O2 |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 2,6-dimethyl-4-nitro-5-(2,2,2-trifluoroethylimino)hept-3-en-3-amine |
| SMILES | CC(C)C(N)=C(/C(=N/CC(F)(F)F)C(C)C)[N+](=O)[O-] |
| InChI | InChI=1S/C11H18F3N3O2/c1-6(2)8(15)10(17(18)19)9(7(3)4)16-5-11(12,13)14/h6-7H,5,15H2,1-4H3/b10-8?,16-9+ |
| InChIKey | JMGXFYVEEGGXDY-WUTZXFCMSA-N |
| XLogP | 2.75 |
| TPSA | 81.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|